C11H18F4N2O2+2 — CID 57105363
(2-fluoro-1,3-dipropyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate (PubChem CID 57105363) has the molecular formula C11H18F4N2O2+2 and a molecular weight of 286.27 g/mol. Its IUPAC name is (2-fluoro-1,3-dipropyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2-fluoro-1,3-dipropyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57105363 |
| Molecular Formula | C11H18F4N2O2+2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2-fluoro-1,3-dipropyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate |
| SMILES | CCC[N+]1=C(F)[N+](CCC)(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F4N2O2/c1-3-5-16-6-8-17(7-4-2,10(16)12)19-9(18)11(13,14)15/h3-8H2,1-2H3/q+2 |
| InChIKey | LDKBAQZIYGVVIU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|