C18H23FO4 — CID 57105588
(3aR,4R,5R,6aS)-4-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 57105588) has the molecular formula C18H23FO4 and a molecular weight of 322.38 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 57105588 |
| Molecular Formula | C18H23FO4 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](CC[C@@H](O)CCc3cccc(F)c3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H23FO4/c19-12-3-1-2-11(8-12)4-5-13(20)6-7-14-15-9-18(22)23-17(15)10-16(14)21/h1-3,8,13-17,20-21H,4-7,9-10H2/t13-,14+,15+,16+,17-/m0/s1 |
| InChIKey | CPLUVDXTFZQKLD-UTSKFRMZSA-N |
| XLogP | 2.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |