About 2-propoxy-3-propyl-2,3-dihydrothiophene
2-propoxy-3-propyl-2,3-dihydrothiophene (PubChem CID 57105878) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-propoxy-3-propyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2-propoxy-3-propyl-2,3-dihydrothiophene |
| PubChem CID | 57105878 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-propoxy-3-propyl-2,3-dihydrothiophene |
| SMILES | CCCOC1SC=CC1CCC |
| InChI | InChI=1S/C10H18OS/c1-3-5-9-6-8-12-10(9)11-7-4-2/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | PWHGIXNKCQDGLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propoxy-3-propyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-3-propyl-2,3-dihydrothiophene?
The IUPAC name of 2-propoxy-3-propyl-2,3-dihydrothiophene (CID 57105878) is 2-propoxy-3-propyl-2,3-dihydrothiophene.
What is the SMILES notation for 2-propoxy-3-propyl-2,3-dihydrothiophene?
The canonical SMILES for 2-propoxy-3-propyl-2,3-dihydrothiophene is CCCOC1SC=CC1CCC.
What is the InChIKey of 2-propoxy-3-propyl-2,3-dihydrothiophene?
The InChIKey is PWHGIXNKCQDGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS/c1-3-5-9-6-8-12-10(9)11-7-4-2/h6,8-10H,3-5,7H2,1-2H3.
What are the key properties of 2-propoxy-3-propyl-2,3-dihydrothiophene?
2-propoxy-3-propyl-2,3-dihydrothiophene has a molecular weight of 186.32 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-3-propyl-2,3-dihydrothiophene is sourced from PubChem (CID 57105878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).