C14H20N6O4 — CID 57105902
(3R,4S,5R)-5-(hydroxymethyl)-2-piperazin-1-yl-2-purin-9-yloxolane-3,4-diol (PubChem CID 57105902) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (3R,4S,5R)-5-(hydroxymethyl)-2-piperazin-1-yl-2-purin-9-yloxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-5-(hydroxymethyl)-2-piperazin-1-yl-2-purin-9-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 57105902 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3R,4S,5R)-5-(hydroxymethyl)-2-piperazin-1-yl-2-purin-9-yloxolane-3,4-diol |
| SMILES | OC[C@H]1OC(N2CCNCC2)(n2cnc3cncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20N6O4/c21-6-10-11(22)12(23)14(24-10,19-3-1-15-2-4-19)20-8-18-9-5-16-7-17-13(9)20/h5,7-8,10-12,15,21-23H,1-4,6H2/t10-,11-,12-,14?/m1/s1 |
| InChIKey | CQXPJLQAOVRCFE-ZXRVKKJVSA-N |
| XLogP | -2.55 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |