C15H14F3NO4S — CID 57105917
(2S)-3-(1-benzofuran-2-yl)-2-[[(2S)-3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid (PubChem CID 57105917) has the molecular formula C15H14F3NO4S and a molecular weight of 361.34 g/mol. Its IUPAC name is (2S)-3-(1-benzofuran-2-yl)-2-[[(2S)-3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1-benzofuran-2-yl)-2-[[(2S)-3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 57105917 |
| Molecular Formula | C15H14F3NO4S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (2S)-3-(1-benzofuran-2-yl)-2-[[(2S)-3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1cc2ccccc2o1)NC(=O)[C@H](CS)C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO4S/c16-15(17,18)10(7-24)13(20)19-11(14(21)22)6-9-5-8-3-1-2-4-12(8)23-9/h1-5,10-11,24H,6-7H2,(H,19,20)(H,21,22)/t10-,11-/m0/s1 |
| InChIKey | WPRBJKDQPRQRID-QWRGUYRKSA-N |
| XLogP | 2.65 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|