C34H60O2SSi2 — CID 57106069
tert-butyl-[4-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hexylsulfanyl-3-methylcyclopent-2-en-1-yl]-1-phenylbut-3-en-2-yl]oxy-dimethylsilane (PubChem CID 57106069) has the molecular formula C34H60O2SSi2 and a molecular weight of 589.09 g/mol. Its IUPAC name is tert-butyl-[4-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hexylsulfanyl-3-methylcyclopent-2-en-1-yl]-1-phenylbut-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hexylsulfanyl-3-methylcyclopent-2-en-1-yl]-1-phenylbut-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 57106069 |
| Molecular Formula | C34H60O2SSi2 |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | tert-butyl-[4-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hexylsulfanyl-3-methylcyclopent-2-en-1-yl]-1-phenylbut-3-en-2-yl]oxy-dimethylsilane |
| SMILES | CCCCCCSC1=C(C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C=CC(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H60O2SSi2/c1-13-14-15-19-24-37-32-27(2)25-31(36-39(11,12)34(6,7)8)30(32)23-22-29(26-28-20-17-16-18-21-28)35-38(9,10)33(3,4)5/h16-18,20-23,29-31H,13-15,19,24-26H2,1-12H3/t29?,30-,31+/m0/s1 |
| InChIKey | NZKSKNNHSMSANG-CJZYSFCQSA-N |
| XLogP | 11.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|