About prop-2-enyl methanesulfinate
prop-2-enyl methanesulfinate (PubChem CID 57106094) has the molecular formula C4H8O2S
and a molecular weight of 120.17 g/mol. Its IUPAC name is prop-2-enyl methanesulfinate.
Molecular Properties
| Compound Name | prop-2-enyl methanesulfinate |
| PubChem CID | 57106094 |
| Molecular Formula | C4H8O2S |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | prop-2-enyl methanesulfinate |
| SMILES | C=CCOS(C)=O |
| InChI | InChI=1S/C4H8O2S/c1-3-4-6-7(2)5/h3H,1,4H2,2H3 |
| InChIKey | WWAFPHBAWGARGQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl methanesulfinate?
The IUPAC name of prop-2-enyl methanesulfinate (CID 57106094) is prop-2-enyl methanesulfinate.
What is the SMILES notation for prop-2-enyl methanesulfinate?
The canonical SMILES for prop-2-enyl methanesulfinate is C=CCOS(C)=O.
What is the InChIKey of prop-2-enyl methanesulfinate?
The InChIKey is WWAFPHBAWGARGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S/c1-3-4-6-7(2)5/h3H,1,4H2,2H3.
What are the key properties of prop-2-enyl methanesulfinate?
prop-2-enyl methanesulfinate has a molecular weight of 120.17 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl methanesulfinate is sourced from PubChem (CID 57106094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).