C21H13F23O5S — CID 57106174
1-[2-[2,2,3,3,4,4,5,5,6,6-decafluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexoxy]ethylsulfonyl]-4-methylbenzene (PubChem CID 57106174) has the molecular formula C21H13F23O5S and a molecular weight of 814.35 g/mol. Its IUPAC name is 1-[2-[2,2,3,3,4,4,5,5,6,6-decafluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexoxy]ethylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[2-[2,2,3,3,4,4,5,5,6,6-decafluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexoxy]ethylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 57106174 |
| Molecular Formula | C21H13F23O5S |
| Molecular Weight | 814.35 g/mol |
| Exact Mass | 814.01 |
| IUPAC Name | 1-[2-[2,2,3,3,4,4,5,5,6,6-decafluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexoxy]ethylsulfonyl]-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13F23O5S/c1-9-2-4-10(5-3-9)50(45,46)7-6-47-8-11(22,23)12(24,25)13(26,27)15(30,31)18(37,38)48-20(41,42)21(43,44)49-19(39,40)16(32,33)14(28,29)17(34,35)36/h2-5H,6-8H2,1H3 |
| InChIKey | WGRICAHPJHTQET-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.35 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|