C24H43NO3 — CID 57106302
N,N-bis(1-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide (PubChem CID 57106302) has the molecular formula C24H43NO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is N,N-bis(1-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide.
| Compound Name | N,N-bis(1-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide |
|---|---|
| PubChem CID | 57106302 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | N,N-bis(1-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)CC(=O)N(C(C)O)C(C)O |
| InChI | InChI=1S/C24H43NO3/c1-18(2)11-8-12-19(3)13-9-14-20(4)15-10-16-21(5)17-24(28)25(22(6)26)23(7)27/h11,13,15,21-23,26-27H,8-10,12,14,16-17H2,1-7H3 |
| InChIKey | HAUJXQLAHWYUSV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|