About 4,5-dimethyl-1H-indol-2-ol
4,5-dimethyl-1H-indol-2-ol (PubChem CID 57106525) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 4,5-dimethyl-1H-indol-2-ol.
Molecular Properties
| Compound Name | 4,5-dimethyl-1H-indol-2-ol |
| PubChem CID | 57106525 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 4,5-dimethyl-1H-indol-2-ol |
| SMILES | Cc1ccc2[nH]c(O)cc2c1C |
| InChI | InChI=1S/C10H11NO/c1-6-3-4-9-8(7(6)2)5-10(12)11-9/h3-5,11-12H,1-2H3 |
| InChIKey | GKONFEJNEPCTOI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethyl-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1H-indol-2-ol?
The IUPAC name of 4,5-dimethyl-1H-indol-2-ol (CID 57106525) is 4,5-dimethyl-1H-indol-2-ol.
What is the SMILES notation for 4,5-dimethyl-1H-indol-2-ol?
The canonical SMILES for 4,5-dimethyl-1H-indol-2-ol is Cc1ccc2[nH]c(O)cc2c1C.
What is the InChIKey of 4,5-dimethyl-1H-indol-2-ol?
The InChIKey is GKONFEJNEPCTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-6-3-4-9-8(7(6)2)5-10(12)11-9/h3-5,11-12H,1-2H3.
What are the key properties of 4,5-dimethyl-1H-indol-2-ol?
4,5-dimethyl-1H-indol-2-ol has a molecular weight of 161.20 g/mol, XLogP of 2.49, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1H-indol-2-ol is sourced from PubChem (CID 57106525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).