About methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate
methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate (PubChem CID 57106591) has the molecular formula C13H15NO5S
and a molecular weight of 297.33 g/mol. Its IUPAC name is methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate |
| PubChem CID | 57106591 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(C)(=O)=O)c(C2=CCON2)c1C |
| InChI | InChI=1S/C13H15NO5S/c1-8-9(13(15)18-2)4-5-11(20(3,16)17)12(8)10-6-7-19-14-10/h4-6,14H,7H2,1-3H3 |
| InChIKey | FCQKUDJMRGHQTC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate?
The IUPAC name of methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate (CID 57106591) is methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate.
What is the SMILES notation for methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate?
The canonical SMILES for methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate is COC(=O)c1ccc(S(C)(=O)=O)c(C2=CCON2)c1C.
What is the InChIKey of methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate?
The InChIKey is FCQKUDJMRGHQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5S/c1-8-9(13(15)18-2)4-5-11(20(3,16)17)12(8)10-6-7-19-14-10/h4-6,14H,7H2,1-3H3.
What are the key properties of methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate?
methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate has a molecular weight of 297.33 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoate is sourced from PubChem (CID 57106591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).