About 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol
2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol (PubChem CID 57106705) has the molecular formula C15H20O2S2
and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol.
Molecular Properties
| Compound Name | 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol |
| PubChem CID | 57106705 |
| Molecular Formula | C15H20O2S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol |
| SMILES | C=CC(C)(O)c1ccc2c(c1)C(SC)(SC)CCO2 |
| InChI | InChI=1S/C15H20O2S2/c1-5-14(2,16)11-6-7-13-12(10-11)15(18-3,19-4)8-9-17-13/h5-7,10,16H,1,8-9H2,2-4H3 |
| InChIKey | DGFIKTHMPFAJKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol?
The IUPAC name of 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol (CID 57106705) is 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol.
What is the SMILES notation for 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol?
The canonical SMILES for 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol is C=CC(C)(O)c1ccc2c(c1)C(SC)(SC)CCO2.
What is the InChIKey of 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol?
The InChIKey is DGFIKTHMPFAJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2S2/c1-5-14(2,16)11-6-7-13-12(10-11)15(18-3,19-4)8-9-17-13/h5-7,10,16H,1,8-9H2,2-4H3.
What are the key properties of 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol?
2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol has a molecular weight of 296.46 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]but-3-en-2-ol is sourced from PubChem (CID 57106705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).