C18H27NO — CID 57106824
(10bS)-4-butyl-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one (PubChem CID 57106824) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (10bS)-4-butyl-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one.
| Compound Name | (10bS)-4-butyl-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one |
|---|---|
| PubChem CID | 57106824 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (10bS)-4-butyl-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one |
| SMILES | CCCCN1C2=CCC3C(=O)CC=CC3[C@@H]2CCC1C |
| InChI | InChI=1S/C18H27NO/c1-3-4-12-19-13(2)8-9-15-14-6-5-7-18(20)16(14)10-11-17(15)19/h5-6,11,13-16H,3-4,7-10,12H2,1-2H3/t13?,14?,15-,16?/m0/s1 |
| InChIKey | VLRHUGAVEHYIEE-UFFJXHMVSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|