C14H20O7 — CID 57107036
[(3R,4S,5S,6R)-4,5-diacetyloxy-6-prop-2-enyloxan-3-yl] acetate (PubChem CID 57107036) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4,5-diacetyloxy-6-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6R)-4,5-diacetyloxy-6-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 57107036 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(3R,4S,5S,6R)-4,5-diacetyloxy-6-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CC[C@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O7/c1-5-6-11-13(20-9(3)16)14(21-10(4)17)12(7-18-11)19-8(2)15/h5,11-14H,1,6-7H2,2-4H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | CAWIZGMBQLFWHG-MQYQWHSLSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|