C16H19NO6 — CID 57107152
5-[(3aR,4R,5R,6aS)-5-acetyloxy-4-formyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]-5-cyanopentanoic acid (PubChem CID 57107152) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-[(3aR,4R,5R,6aS)-5-acetyloxy-4-formyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]-5-cyanopentanoic acid.
| Compound Name | 5-[(3aR,4R,5R,6aS)-5-acetyloxy-4-formyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]-5-cyanopentanoic acid |
|---|---|
| PubChem CID | 57107152 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-[(3aR,4R,5R,6aS)-5-acetyloxy-4-formyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]-5-cyanopentanoic acid |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2OC(=C(C#N)CCCC(=O)O)C[C@@H]2[C@H]1C=O |
| InChI | InChI=1S/C16H19NO6/c1-9(19)22-15-6-14-11(12(15)8-18)5-13(23-14)10(7-17)3-2-4-16(20)21/h8,11-12,14-15H,2-6H2,1H3,(H,20,21)/t11-,12-,14+,15-/m1/s1 |
| InChIKey | WKELCLQRKMXSNZ-RJZRQDKASA-N |
| XLogP | 1.57 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|