C20H12O6 — CID 57107481
3-[4-(2-carboxyethenyl)-9,10-dioxoanthracen-1-yl]prop-2-enoic acid (PubChem CID 57107481) has the molecular formula C20H12O6 and a molecular weight of 348.31 g/mol. Its IUPAC name is 3-[4-(2-carboxyethenyl)-9,10-dioxoanthracen-1-yl]prop-2-enoic acid.
| Compound Name | 3-[4-(2-carboxyethenyl)-9,10-dioxoanthracen-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 57107481 |
| Molecular Formula | C20H12O6 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-[4-(2-carboxyethenyl)-9,10-dioxoanthracen-1-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C=CC(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H12O6/c21-15(22)9-7-11-5-6-12(8-10-16(23)24)18-17(11)19(25)13-3-1-2-4-14(13)20(18)26/h1-10H,(H,21,22)(H,23,24) |
| InChIKey | HLCDIQVGALODQD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|