About [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol
[3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol (PubChem CID 57107934) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol |
| PubChem CID | 57107934 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol |
| SMILES | OCc1cc(CO)sn1 |
| InChI | InChI=1S/C5H7NO2S/c7-2-4-1-5(3-8)9-6-4/h1,7-8H,2-3H2 |
| InChIKey | MTADTHDLHKMCSK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol?
The IUPAC name of [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol (CID 57107934) is [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol is OCc1cc(CO)sn1.
What is the InChIKey of [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol?
The InChIKey is MTADTHDLHKMCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c7-2-4-1-5(3-8)9-6-4/h1,7-8H,2-3H2.
What are the key properties of [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol?
[3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol has a molecular weight of 145.18 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-1,2-thiazol-5-yl]methanol is sourced from PubChem (CID 57107934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).