About 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide
5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide (PubChem CID 57108215) has the molecular formula C14H18N2O2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide |
| PubChem CID | 57108215 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ncc(C(C)(C)C)o1)c1cccs1 |
| InChI | InChI=1S/C14H18N2O2S/c1-9(10-6-5-7-19-10)16-12(17)13-15-8-11(18-13)14(2,3)4/h5-9H,1-4H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | IOJYBDXOCWJPLJ-SECBINFHSA-N |
| XLogP | 3.52 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide?
The IUPAC name of 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide (CID 57108215) is 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide.
What is the SMILES notation for 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide?
The canonical SMILES for 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide is C[C@@H](NC(=O)c1ncc(C(C)(C)C)o1)c1cccs1.
What is the InChIKey of 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide?
The InChIKey is IOJYBDXOCWJPLJ-SECBINFHSA-N. The full InChI is InChI=1S/C14H18N2O2S/c1-9(10-6-5-7-19-10)16-12(17)13-15-8-11(18-13)14(2,3)4/h5-9H,1-4H3,(H,16,17)/t9-/m1/s1.
What are the key properties of 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide?
5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide has a molecular weight of 278.38 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-[(1R)-1-thiophen-2-ylethyl]-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 57108215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).