About 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine
2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine (PubChem CID 57108240) has the molecular formula C23H21ClN2
and a molecular weight of 360.89 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine.
Molecular Properties
| Compound Name | 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine |
| PubChem CID | 57108240 |
| Molecular Formula | C23H21ClN2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine |
| SMILES | Clc1ccc(C2=CCN(Cc3cccc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C23H21ClN2/c24-21-11-9-18(10-12-21)19-13-15-26(16-14-19)17-22-7-4-8-23(25-22)20-5-2-1-3-6-20/h1-13H,14-17H2 |
| InChIKey | MXVMXFFGXQGGRV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine?
The IUPAC name of 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine (CID 57108240) is 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine.
What is the SMILES notation for 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine?
The canonical SMILES for 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine is Clc1ccc(C2=CCN(Cc3cccc(-c4ccccc4)n3)CC2)cc1.
What is the InChIKey of 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine?
The InChIKey is MXVMXFFGXQGGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN2/c24-21-11-9-18(10-12-21)19-13-15-26(16-14-19)17-22-7-4-8-23(25-22)20-5-2-1-3-6-20/h1-13H,14-17H2.
What are the key properties of 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine?
2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine has a molecular weight of 360.89 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-6-phenylpyridine is sourced from PubChem (CID 57108240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).