C18H20Cl7NO4 — CID 57108629
1-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-N-(2,2,2-trichloroethoxy)prop-1-en-2-amine (PubChem CID 57108629) has the molecular formula C18H20Cl7NO4 and a molecular weight of 562.53 g/mol. Its IUPAC name is 1-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-N-(2,2,2-trichloroethoxy)prop-1-en-2-amine.
| Compound Name | 1-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-N-(2,2,2-trichloroethoxy)prop-1-en-2-amine |
|---|---|
| PubChem CID | 57108629 |
| Molecular Formula | C18H20Cl7NO4 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 558.92 |
| IUPAC Name | 1-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-N-(2,2,2-trichloroethoxy)prop-1-en-2-amine |
| SMILES | CC(=COCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)NOCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H20Cl7NO4/c1-12(26-30-11-18(23,24)25)10-27-5-2-3-6-29-17-14(19)8-13(9-15(17)20)28-7-4-16(21)22/h4,8-10,26H,2-3,5-7,11H2,1H3 |
| InChIKey | NORQKXBLTSPWDH-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|