C6H10Br2Cl2O2 — CID 57108835
1,3-dibromo-1,3-dichlorohexane-2,4-diol (PubChem CID 57108835) has the molecular formula C6H10Br2Cl2O2 and a molecular weight of 344.86 g/mol. Its IUPAC name is 1,3-dibromo-1,3-dichlorohexane-2,4-diol.
| Compound Name | 1,3-dibromo-1,3-dichlorohexane-2,4-diol |
|---|---|
| PubChem CID | 57108835 |
| Molecular Formula | C6H10Br2Cl2O2 |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 341.84 |
| IUPAC Name | 1,3-dibromo-1,3-dichlorohexane-2,4-diol |
| SMILES | CCC(O)C(Cl)(Br)C(O)C(Cl)Br |
| InChI | InChI=1S/C6H10Br2Cl2O2/c1-2-3(11)6(8,10)4(12)5(7)9/h3-5,11-12H,2H2,1H3 |
| InChIKey | IUCJIPZREHXLPU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|