C25H29N3O3 — CID 57109114
2-oxo-N-[2-[2-oxo-2-[1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]phenyl]propanamide (PubChem CID 57109114) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-oxo-N-[2-[2-oxo-2-[1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]phenyl]propanamide.
| Compound Name | 2-oxo-N-[2-[2-oxo-2-[1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]phenyl]propanamide |
|---|---|
| PubChem CID | 57109114 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-oxo-N-[2-[2-oxo-2-[1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]phenyl]propanamide |
| SMILES | CC(=O)C(=O)Nc1ccccc1CC(=O)N1CCc2ccccc2C1CN1CCCC1 |
| InChI | InChI=1S/C25H29N3O3/c1-18(29)25(31)26-22-11-5-3-9-20(22)16-24(30)28-15-12-19-8-2-4-10-21(19)23(28)17-27-13-6-7-14-27/h2-5,8-11,23H,6-7,12-17H2,1H3,(H,26,31) |
| InChIKey | MIMVIFDVGWUJME-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|