About 2,3-bis(diethylamino)butane-1,3-diol
2,3-bis(diethylamino)butane-1,3-diol (PubChem CID 57109468) has the molecular formula C12H28N2O2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 2,3-bis(diethylamino)butane-1,3-diol.
Molecular Properties
| Compound Name | 2,3-bis(diethylamino)butane-1,3-diol |
| PubChem CID | 57109468 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2,3-bis(diethylamino)butane-1,3-diol |
| SMILES | CCN(CC)C(CO)C(C)(O)N(CC)CC |
| InChI | InChI=1S/C12H28N2O2/c1-6-13(7-2)11(10-15)12(5,16)14(8-3)9-4/h11,15-16H,6-10H2,1-5H3 |
| InChIKey | QKDJBMRBAHWPPR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(diethylamino)butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(diethylamino)butane-1,3-diol?
The IUPAC name of 2,3-bis(diethylamino)butane-1,3-diol (CID 57109468) is 2,3-bis(diethylamino)butane-1,3-diol.
What is the SMILES notation for 2,3-bis(diethylamino)butane-1,3-diol?
The canonical SMILES for 2,3-bis(diethylamino)butane-1,3-diol is CCN(CC)C(CO)C(C)(O)N(CC)CC.
What is the InChIKey of 2,3-bis(diethylamino)butane-1,3-diol?
The InChIKey is QKDJBMRBAHWPPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O2/c1-6-13(7-2)11(10-15)12(5,16)14(8-3)9-4/h11,15-16H,6-10H2,1-5H3.
What are the key properties of 2,3-bis(diethylamino)butane-1,3-diol?
2,3-bis(diethylamino)butane-1,3-diol has a molecular weight of 232.37 g/mol, XLogP of 0.74, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(diethylamino)butane-1,3-diol is sourced from PubChem (CID 57109468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).