About (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol
(2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol (PubChem CID 57109855) has the molecular formula C22H30O3S
and a molecular weight of 374.55 g/mol. Its IUPAC name is (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol.
Molecular Properties
| Compound Name | (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol |
| PubChem CID | 57109855 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol |
| SMILES | CC(C)(C)c1ccc2c(c1)C(CO)c1cc(C(C)(C)C)ccc1S2(O)O |
| InChI | InChI=1S/C22H30O3S/c1-21(2,3)14-7-9-19-16(11-14)18(13-23)17-12-15(22(4,5)6)8-10-20(17)26(19,24)25/h7-12,18,23-25H,13H2,1-6H3 |
| InChIKey | MUVUNNIYHSJCGZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol?
The IUPAC name of (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol (CID 57109855) is (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol.
What is the SMILES notation for (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol?
The canonical SMILES for (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol is CC(C)(C)c1ccc2c(c1)C(CO)c1cc(C(C)(C)C)ccc1S2(O)O.
What is the InChIKey of (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol?
The InChIKey is MUVUNNIYHSJCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O3S/c1-21(2,3)14-7-9-19-16(11-14)18(13-23)17-12-15(22(4,5)6)8-10-20(17)26(19,24)25/h7-12,18,23-25H,13H2,1-6H3.
What are the key properties of (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol?
(2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol has a molecular weight of 374.55 g/mol, XLogP of 5.89, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-ditert-butyl-10,10-dihydroxy-9H-thioxanthen-9-yl)methanol is sourced from PubChem (CID 57109855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).