C23H37F3O4 — CID 57109884
5-[(2S,3aR,4R,6aS)-4-[(3R,4R)-3,4-dimethyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid (PubChem CID 57109884) has the molecular formula C23H37F3O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[(2S,3aR,4R,6aS)-4-[(3R,4R)-3,4-dimethyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid.
| Compound Name | 5-[(2S,3aR,4R,6aS)-4-[(3R,4R)-3,4-dimethyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid |
|---|---|
| PubChem CID | 57109884 |
| Molecular Formula | C23H37F3O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 5-[(2S,3aR,4R,6aS)-4-[(3R,4R)-3,4-dimethyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid |
| SMILES | CCCC[C@](C)([C@H](C)C=C[C@H]1CC[C@@H]2O[C@@H](CCCCC(=O)OO)C[C@@H]21)C(F)(F)F |
| InChI | InChI=1S/C23H37F3O4/c1-4-5-14-22(3,23(24,25)26)16(2)10-11-17-12-13-20-19(17)15-18(29-20)8-6-7-9-21(27)30-28/h10-11,16-20,28H,4-9,12-15H2,1-3H3/t16-,17+,18+,19-,20+,22-/m1/s1 |
| InChIKey | SPQIPXOGSQGZKJ-ZJICWGJPSA-N |
| XLogP | 6.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|