C21H24NO3+ — CID 57109977
(2R)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methoxy-2-methyl-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-ium (PubChem CID 57109977) has the molecular formula C21H24NO3+ and a molecular weight of 338.43 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methoxy-2-methyl-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-ium.
| Compound Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methoxy-2-methyl-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-ium |
|---|---|
| PubChem CID | 57109977 |
| Molecular Formula | C21H24NO3+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methoxy-2-methyl-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-ium |
| SMILES | COC1c2ccccc2C2C[N@@+](C)(C3COc4ccccc4O3)CC21 |
| InChI | InChI=1S/C21H24NO3/c1-22(20-13-24-18-9-5-6-10-19(18)25-20)11-16-14-7-3-4-8-15(14)21(23-2)17(16)12-22/h3-10,16-17,20-21H,11-13H2,1-2H3/q+1/t16?,17?,20?,21?,22-/m1/s1 |
| InChIKey | PJKPQBDYOLYGAU-KSDPEUJXSA-N |
| XLogP | 3.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|