C16H21NOS — CID 57110160
(R)-(2-ethyl-3-methyl-1-benzothiophen-7-yl)-[(2S)-pyrrolidin-2-yl]methanol (PubChem CID 57110160) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is (R)-(2-ethyl-3-methyl-1-benzothiophen-7-yl)-[(2S)-pyrrolidin-2-yl]methanol.
| Compound Name | (R)-(2-ethyl-3-methyl-1-benzothiophen-7-yl)-[(2S)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 57110160 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (R)-(2-ethyl-3-methyl-1-benzothiophen-7-yl)-[(2S)-pyrrolidin-2-yl]methanol |
| SMILES | CCc1sc2c([C@@H](O)[C@@H]3CCCN3)cccc2c1C |
| InChI | InChI=1S/C16H21NOS/c1-3-14-10(2)11-6-4-7-12(16(11)19-14)15(18)13-8-5-9-17-13/h4,6-7,13,15,17-18H,3,5,8-9H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | ZBEOFTGUHAWLGB-DZGCQCFKSA-N |
| XLogP | 3.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |