C14H20N5O2+ — CID 57110416
N-[2-(dimethylamino)ethyl]-4-(3-oxo-2,4-dihydro-1H-1,3,5-triazin-3-ium-6-yl)benzamide (PubChem CID 57110416) has the molecular formula C14H20N5O2+ and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(3-oxo-2,4-dihydro-1H-1,3,5-triazin-3-ium-6-yl)benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(3-oxo-2,4-dihydro-1H-1,3,5-triazin-3-ium-6-yl)benzamide |
|---|---|
| PubChem CID | 57110416 |
| Molecular Formula | C14H20N5O2+ |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(3-oxo-2,4-dihydro-1H-1,3,5-triazin-3-ium-6-yl)benzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(C2=NC[N+](=O)CN2)cc1 |
| InChI | InChI=1S/C14H19N5O2/c1-18(2)8-7-15-14(20)12-5-3-11(4-6-12)13-16-9-19(21)10-17-13/h3-6H,7-10H2,1-2H3,(H-,15,16,17,20)/p+1 |
| InChIKey | FCUQQQCKYSPQGN-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|