About 1-chloro-1,2,4a,8a-tetrahydronaphthalene
1-chloro-1,2,4a,8a-tetrahydronaphthalene (PubChem CID 57110521) has the molecular formula C10H11Cl
and a molecular weight of 166.65 g/mol. Its IUPAC name is 1-chloro-1,2,4a,8a-tetrahydronaphthalene.
Molecular Properties
| Compound Name | 1-chloro-1,2,4a,8a-tetrahydronaphthalene |
| PubChem CID | 57110521 |
| Molecular Formula | C10H11Cl |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-chloro-1,2,4a,8a-tetrahydronaphthalene |
| SMILES | ClC1CC=CC2C=CC=CC21 |
| InChI | InChI=1S/C10H11Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-6,8-10H,7H2 |
| InChIKey | BRFRJRJNARJCMQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,2,4a,8a-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,2,4a,8a-tetrahydronaphthalene?
The IUPAC name of 1-chloro-1,2,4a,8a-tetrahydronaphthalene (CID 57110521) is 1-chloro-1,2,4a,8a-tetrahydronaphthalene.
What is the SMILES notation for 1-chloro-1,2,4a,8a-tetrahydronaphthalene?
The canonical SMILES for 1-chloro-1,2,4a,8a-tetrahydronaphthalene is ClC1CC=CC2C=CC=CC21.
What is the InChIKey of 1-chloro-1,2,4a,8a-tetrahydronaphthalene?
The InChIKey is BRFRJRJNARJCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-6,8-10H,7H2.
What are the key properties of 1-chloro-1,2,4a,8a-tetrahydronaphthalene?
1-chloro-1,2,4a,8a-tetrahydronaphthalene has a molecular weight of 166.65 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,2,4a,8a-tetrahydronaphthalene is sourced from PubChem (CID 57110521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).