C19H33NO4 — CID 57110916
tert-butyl N-[(2S,3R,4S)-1-cyclohexa-1,4-dien-1-yl-3,4-dihydroxy-6-methylheptan-2-yl]carbamate (PubChem CID 57110916) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4S)-1-cyclohexa-1,4-dien-1-yl-3,4-dihydroxy-6-methylheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4S)-1-cyclohexa-1,4-dien-1-yl-3,4-dihydroxy-6-methylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 57110916 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | tert-butyl N-[(2S,3R,4S)-1-cyclohexa-1,4-dien-1-yl-3,4-dihydroxy-6-methylheptan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1=CCC=CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO4/c1-13(2)11-16(21)17(22)15(12-14-9-7-6-8-10-14)20-18(23)24-19(3,4)5/h6-7,10,13,15-17,21-22H,8-9,11-12H2,1-5H3,(H,20,23)/t15-,16-,17+/m0/s1 |
| InChIKey | NTQGSQXLHBRQDQ-YESZJQIVSA-N |
| XLogP | 3.31 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|