C26H41O3P — CID 57110976
trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-dimethylphosphorylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 57110976) has the molecular formula C26H41O3P and a molecular weight of 432.59 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-dimethylphosphorylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-dimethylphosphorylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 57110976 |
| Molecular Formula | C26H41O3P |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-dimethylphosphorylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)C=CCP(C)(C)=O)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H41O3P/c1-18(8-7-15-30(4,5)29)23-12-13-24-20(9-6-14-26(23,24)3)10-11-21-16-22(27)17-25(28)19(21)2/h7-8,10-11,18,22-25,27-28H,2,6,9,12-17H2,1,3-5H3/t18-,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | IVEOFWARNUHQQD-YCNLZJMHSA-N |
| XLogP | 5.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|