About 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]
8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (PubChem CID 57111103) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
Molecular Properties
| Compound Name | 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| PubChem CID | 57111103 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| SMILES | CCCOC12CCC=CC1C(C)C21OCCO1 |
| InChI | InChI=1S/C14H22O3/c1-3-8-15-13-7-5-4-6-12(13)11(2)14(13)16-9-10-17-14/h4,6,11-12H,3,5,7-10H2,1-2H3 |
| InChIKey | GPPIRTZRSCICNB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The IUPAC name of 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (CID 57111103) is 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
What is the SMILES notation for 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The canonical SMILES for 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] is CCCOC12CCC=CC1C(C)C21OCCO1.
What is the InChIKey of 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The InChIKey is GPPIRTZRSCICNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-3-8-15-13-7-5-4-6-12(13)11(2)14(13)16-9-10-17-14/h4,6,11-12H,3,5,7-10H2,1-2H3.
What are the key properties of 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] has a molecular weight of 238.33 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8'-methyl-6'-propoxyspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] is sourced from PubChem (CID 57111103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).