About [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate
[1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate (PubChem CID 57111153) has the molecular formula C20H19F6NO4S
and a molecular weight of 483.43 g/mol. Its IUPAC name is [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate |
| PubChem CID | 57111153 |
| Molecular Formula | C20H19F6NO4S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)(C(=O)NCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C20H19F6NO4S/c1-18(31-32(2,29)30,14-6-4-3-5-7-14)17(28)27-9-8-13-10-15(19(21,22)23)12-16(11-13)20(24,25)26/h3-7,10-12H,8-9H2,1-2H3,(H,27,28) |
| InChIKey | GBEHSRSENYXJKT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate?
The IUPAC name of [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate (CID 57111153) is [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate.
What is the SMILES notation for [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate?
The canonical SMILES for [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate is CC(OS(C)(=O)=O)(C(=O)NCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate?
The InChIKey is GBEHSRSENYXJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F6NO4S/c1-18(31-32(2,29)30,14-6-4-3-5-7-14)17(28)27-9-8-13-10-15(19(21,22)23)12-16(11-13)20(24,25)26/h3-7,10-12H,8-9H2,1-2H3,(H,27,28).
What are the key properties of [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate?
[1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate has a molecular weight of 483.43 g/mol, XLogP of 4.27, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-[3,5-bis(trifluoromethyl)phenyl]ethylamino]-1-oxo-2-phenylpropan-2-yl] methanesulfonate is sourced from PubChem (CID 57111153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).