About 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid
2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid (PubChem CID 57111242) has the molecular formula C11H18O3S
and a molecular weight of 230.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 57111242 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(CC2C(C(=O)O)C2(C)C)OCCS1 |
| InChI | InChI=1S/C11H18O3S/c1-10(2)7(8(10)9(12)13)6-11(3)14-4-5-15-11/h7-8H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | JLZBWIKZZGMLBS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid (CID 57111242) is 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid is CC1(CC2C(C(=O)O)C2(C)C)OCCS1.
What is the InChIKey of 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid?
The InChIKey is JLZBWIKZZGMLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3S/c1-10(2)7(8(10)9(12)13)6-11(3)14-4-5-15-11/h7-8H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid?
2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid has a molecular weight of 230.33 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 57111242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).