C10H6N8O4 — CID 57111364
9-(2,6-dioxo-3H-purin-9-yl)-3H-purine-2,6-dione (PubChem CID 57111364) has the molecular formula C10H6N8O4 and a molecular weight of 302.21 g/mol. Its IUPAC name is 9-(2,6-dioxo-3H-purin-9-yl)-3H-purine-2,6-dione.
| Compound Name | 9-(2,6-dioxo-3H-purin-9-yl)-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 57111364 |
| Molecular Formula | C10H6N8O4 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 9-(2,6-dioxo-3H-purin-9-yl)-3H-purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2ncn(-n3cnc4c(=O)[nH]c(=O)[nH]c43)c2[nH]1 |
| InChI | InChI=1S/C10H6N8O4/c19-7-3-5(13-9(21)15-7)17(1-11-3)18-2-12-4-6(18)14-10(22)16-8(4)20/h1-2H,(H2,13,15,19,21)(H2,14,16,20,22) |
| InChIKey | LLFQXBCTHVBLEI-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |