About (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid
(2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57111445) has the molecular formula C12H20NO3S+
and a molecular weight of 258.36 g/mol. Its IUPAC name is (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| PubChem CID | 57111445 |
| Molecular Formula | C12H20NO3S+ |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)C(C)(C)C(=S)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C12H19NO3S/c1-8-6-5-7-13(8,11(15)16)10(17)12(3,4)9(2)14/h8H,5-7H2,1-4H3/p+1/t8-,13?/m1/s1 |
| InChIKey | FNLKTFFZDZTPCF-UOGPZTOASA-O |
| XLogP | 2.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The IUPAC name of (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (CID 57111445) is (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
What is the SMILES notation for (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The canonical SMILES for (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid is CC(=O)C(C)(C)C(=S)[N+]1(C(=O)O)CCC[C@H]1C.
What is the InChIKey of (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The InChIKey is FNLKTFFZDZTPCF-UOGPZTOASA-O. The full InChI is InChI=1S/C12H19NO3S/c1-8-6-5-7-13(8,11(15)16)10(17)12(3,4)9(2)14/h8H,5-7H2,1-4H3/p+1/t8-,13?/m1/s1.
What are the key properties of (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
(2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid has a molecular weight of 258.36 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(2,2-dimethyl-3-oxobutanethioyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid is sourced from PubChem (CID 57111445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).