C18H30N4 — CID 57111943
3,9-dimethyl-2-phenyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane (PubChem CID 57111943) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is 3,9-dimethyl-2-phenyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane.
| Compound Name | 3,9-dimethyl-2-phenyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane |
|---|---|
| PubChem CID | 57111943 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 3,9-dimethyl-2-phenyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane |
| SMILES | CC1CN2CCNC(C)C(c3ccccc3)N(CCN1)CC2 |
| InChI | InChI=1S/C18H30N4/c1-15-14-21-10-8-20-16(2)18(17-6-4-3-5-7-17)22(13-12-21)11-9-19-15/h3-7,15-16,18-20H,8-14H2,1-2H3 |
| InChIKey | RVWKUFRHCCEQGK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |