C15H12ClNOS — CID 57112017
5-(2-chloroethyl)-3-(thiophen-2-ylmethylidene)-1H-indol-2-one (PubChem CID 57112017) has the molecular formula C15H12ClNOS and a molecular weight of 289.79 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-(thiophen-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | 5-(2-chloroethyl)-3-(thiophen-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 57112017 |
| Molecular Formula | C15H12ClNOS |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-(2-chloroethyl)-3-(thiophen-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(CCCl)cc2C1=Cc1cccs1 |
| InChI | InChI=1S/C15H12ClNOS/c16-6-5-10-3-4-14-12(8-10)13(15(18)17-14)9-11-2-1-7-19-11/h1-4,7-9H,5-6H2,(H,17,18) |
| InChIKey | DRTHZJYGDLQFJV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|