C12H18O6 — CID 57112027
(1S,4R,5S)-4-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-1,5-dihydroxy-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 57112027) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (1S,4R,5S)-4-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-1,5-dihydroxy-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,4R,5S)-4-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-1,5-dihydroxy-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 57112027 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (1S,4R,5S)-4-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-1,5-dihydroxy-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | CC1(C)C(O)[C@]1(O)[C@H]1OC(=O)[C@]2(O)C(C)(C)[C@]12O |
| InChI | InChI=1S/C12H18O6/c1-8(2)5(13)10(8,15)6-11(16)9(3,4)12(11,17)7(14)18-6/h5-6,13,15-17H,1-4H3/t5?,6-,10+,11-,12+/m1/s1 |
| InChIKey | IROSUUDIEKGUNE-SOJAUAOJSA-N |
| XLogP | -1.45 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |