C23H40O4 — CID 57112137
(2R,3R)-2-cyclopentyl-2-hydroxy-7,7-dimethyl-4-oxo-3-pent-2-enylundecanoic acid (PubChem CID 57112137) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (2R,3R)-2-cyclopentyl-2-hydroxy-7,7-dimethyl-4-oxo-3-pent-2-enylundecanoic acid.
| Compound Name | (2R,3R)-2-cyclopentyl-2-hydroxy-7,7-dimethyl-4-oxo-3-pent-2-enylundecanoic acid |
|---|---|
| PubChem CID | 57112137 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (2R,3R)-2-cyclopentyl-2-hydroxy-7,7-dimethyl-4-oxo-3-pent-2-enylundecanoic acid |
| SMILES | CCC=CC[C@@H](C(=O)CCC(C)(C)CCCC)[C@@](O)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C23H40O4/c1-5-7-9-14-19(20(24)15-17-22(3,4)16-8-6-2)23(27,21(25)26)18-12-10-11-13-18/h7,9,18-19,27H,5-6,8,10-17H2,1-4H3,(H,25,26)/t19-,23+/m0/s1 |
| InChIKey | TZTPOSWRMMZRQC-WMZHIEFXSA-N |
| XLogP | 5.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|