C34H63NO7S — CID 57112245
(2S)-3-[(2R)-2,3-di(decanoyloxy)propyl]sulfanyl-2-(octanoylamino)propanoic acid (PubChem CID 57112245) has the molecular formula C34H63NO7S and a molecular weight of 629.95 g/mol. Its IUPAC name is (2S)-3-[(2R)-2,3-di(decanoyloxy)propyl]sulfanyl-2-(octanoylamino)propanoic acid.
| Compound Name | (2S)-3-[(2R)-2,3-di(decanoyloxy)propyl]sulfanyl-2-(octanoylamino)propanoic acid |
|---|---|
| PubChem CID | 57112245 |
| Molecular Formula | C34H63NO7S |
| Molecular Weight | 629.95 g/mol |
| Exact Mass | 629.43 |
| IUPAC Name | (2S)-3-[(2R)-2,3-di(decanoyloxy)propyl]sulfanyl-2-(octanoylamino)propanoic acid |
| SMILES | CCCCCCCCCC(=O)OC[C@H](CSC[C@@H](NC(=O)CCCCCCC)C(=O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C34H63NO7S/c1-4-7-10-13-15-18-21-24-32(37)41-26-29(42-33(38)25-22-19-16-14-11-8-5-2)27-43-28-30(34(39)40)35-31(36)23-20-17-12-9-6-3/h29-30H,4-28H2,1-3H3,(H,35,36)(H,39,40)/t29-,30-/m1/s1 |
| InChIKey | OJWJWVXAEWXFOD-LOYHVIPDSA-N |
| XLogP | 8.39 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.95 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|