C19H28N2O — CID 57112247
2-[2-[6-(benzylamino)hexyl]pyrrol-2-yl]ethanol (PubChem CID 57112247) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-[2-[6-(benzylamino)hexyl]pyrrol-2-yl]ethanol.
| Compound Name | 2-[2-[6-(benzylamino)hexyl]pyrrol-2-yl]ethanol |
|---|---|
| PubChem CID | 57112247 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-[2-[6-(benzylamino)hexyl]pyrrol-2-yl]ethanol |
| SMILES | OCCC1(CCCCCCNCc2ccccc2)C=CC=N1 |
| InChI | InChI=1S/C19H28N2O/c22-16-13-19(12-8-15-21-19)11-6-1-2-7-14-20-17-18-9-4-3-5-10-18/h3-5,8-10,12,15,20,22H,1-2,6-7,11,13-14,16-17H2 |
| InChIKey | FLJBAYQDMQTSFJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|