C22H34O4 — CID 57112691
2-hydroxy-7-[(1R)-2-(4-methylnonyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 57112691) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R)-2-(4-methylnonyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-hydroxy-7-[(1R)-2-(4-methylnonyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 57112691 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-hydroxy-7-[(1R)-2-(4-methylnonyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCCC(C)CCCC1=CCC(=O)[C@@H]1CCC=C=CC(O)C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-3-4-6-10-17(2)11-9-12-18-15-16-20(23)19(18)13-7-5-8-14-21(24)22(25)26/h5,14-15,17,19,21,24H,3-4,6-7,9-13,16H2,1-2H3,(H,25,26)/t8?,17?,19-,21?/m1/s1 |
| InChIKey | AZRVUZRVGWVMFO-KEZXTXSLSA-N |
| XLogP | 4.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|