C43H68N4O11 — CID 57112765
12-[1-(4-azido-3-methoxycyclohexyl)prop-1-en-2-yl]-17-ethyl-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone (PubChem CID 57112765) has the molecular formula C43H68N4O11 and a molecular weight of 817.03 g/mol. Its IUPAC name is 12-[1-(4-azido-3-methoxycyclohexyl)prop-1-en-2-yl]-17-ethyl-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone.
| Compound Name | 12-[1-(4-azido-3-methoxycyclohexyl)prop-1-en-2-yl]-17-ethyl-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
|---|---|
| PubChem CID | 57112765 |
| Molecular Formula | C43H68N4O11 |
| Molecular Weight | 817.03 g/mol |
| Exact Mass | 816.49 |
| IUPAC Name | 12-[1-(4-azido-3-methoxycyclohexyl)prop-1-en-2-yl]-17-ethyl-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
| SMILES | CCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C)=CC3CCC(N=[N+]=[N-])C(OC)C3)C(C)C(O)CC1=O)C(C)CC2OC |
| InChI | InChI=1S/C43H68N4O11/c1-10-30-18-24(2)17-25(3)19-36(55-8)39-37(56-9)21-27(5)43(53,58-39)40(50)41(51)47-16-12-11-13-32(47)42(52)57-38(28(6)33(48)23-34(30)49)26(4)20-29-14-15-31(45-46-44)35(22-29)54-7/h18,20,25,27-33,35-39,48,53H,10-17,19,21-23H2,1-9H3 |
| InChIKey | HRGJBAKXUVHMAR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 206.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.03 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|