C28H51N — CID 57112797
N,N-dibutyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine (PubChem CID 57112797) has the molecular formula C28H51N and a molecular weight of 401.72 g/mol. Its IUPAC name is N,N-dibutyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine.
| Compound Name | N,N-dibutyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine |
|---|---|
| PubChem CID | 57112797 |
| Molecular Formula | C28H51N |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.40 |
| IUPAC Name | N,N-dibutyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine |
| SMILES | CCCCN(CCCC)C(C=C(C)CCC=C(C)C)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C28H51N/c1-9-11-21-29(22-12-10-2)28(23-27(8)18-14-16-25(5)6)20-19-26(7)17-13-15-24(3)4/h15-16,19,23,28H,9-14,17-18,20-22H2,1-8H3 |
| InChIKey | UTOZSBRVTFRCOR-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|