C19H28F3NO5S — CID 57112800
N-[3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]butane-1-sulfonamide (PubChem CID 57112800) has the molecular formula C19H28F3NO5S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]butane-1-sulfonamide.
| Compound Name | N-[3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 57112800 |
| Molecular Formula | C19H28F3NO5S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1c2cc(OCCCC(F)(F)F)ccc2OC(C)(C)C1O |
| InChI | InChI=1S/C19H28F3NO5S/c1-4-5-11-29(25,26)23-16-14-12-13(27-10-6-9-19(20,21)22)7-8-15(14)28-18(2,3)17(16)24/h7-8,12,16-17,23-24H,4-6,9-11H2,1-3H3 |
| InChIKey | NLMGTIVIFLAHJA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|