About [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium
[1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium (PubChem CID 57112831) has the molecular formula C10H7N2S+
and a molecular weight of 187.25 g/mol. Its IUPAC name is [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium.
Molecular Properties
| Compound Name | [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium |
| PubChem CID | 57112831 |
| Molecular Formula | C10H7N2S+ |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium |
| SMILES | c1cnc2ccc3scc[n+]3c2c1 |
| InChI | InChI=1S/C10H7N2S/c1-2-9-8(11-5-1)3-4-10-12(9)6-7-13-10/h1-7H/q+1 |
| InChIKey | ZRUXDCDOYIKMIU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium?
The IUPAC name of [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium (CID 57112831) is [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium.
What is the SMILES notation for [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium?
The canonical SMILES for [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium is c1cnc2ccc3scc[n+]3c2c1.
What is the InChIKey of [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium?
The InChIKey is ZRUXDCDOYIKMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N2S/c1-2-9-8(11-5-1)3-4-10-12(9)6-7-13-10/h1-7H/q+1.
What are the key properties of [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium?
[1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium has a molecular weight of 187.25 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]thiazolo[3,2-a][1,5]naphthyridin-10-ium is sourced from PubChem (CID 57112831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).