About 2-(diazenylmethyl)-N,N-dimethylaniline
2-(diazenylmethyl)-N,N-dimethylaniline (PubChem CID 57112857) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(diazenylmethyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(diazenylmethyl)-N,N-dimethylaniline |
| PubChem CID | 57112857 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-(diazenylmethyl)-N,N-dimethylaniline |
| SMILES | [H]/N=N/Cc1ccccc1N(C)C |
| InChI | InChI=1S/C9H13N3/c1-12(2)9-6-4-3-5-8(9)7-11-10/h3-6,10H,7H2,1-2H3/b11-10+ |
| InChIKey | OFJXXRWTPLUJFD-ZHACJKMWSA-N |
| XLogP | 2.28 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(diazenylmethyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diazenylmethyl)-N,N-dimethylaniline?
The IUPAC name of 2-(diazenylmethyl)-N,N-dimethylaniline (CID 57112857) is 2-(diazenylmethyl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(diazenylmethyl)-N,N-dimethylaniline?
The canonical SMILES for 2-(diazenylmethyl)-N,N-dimethylaniline is [H]/N=N/Cc1ccccc1N(C)C.
What is the InChIKey of 2-(diazenylmethyl)-N,N-dimethylaniline?
The InChIKey is OFJXXRWTPLUJFD-ZHACJKMWSA-N. The full InChI is InChI=1S/C9H13N3/c1-12(2)9-6-4-3-5-8(9)7-11-10/h3-6,10H,7H2,1-2H3/b11-10+.
What are the key properties of 2-(diazenylmethyl)-N,N-dimethylaniline?
2-(diazenylmethyl)-N,N-dimethylaniline has a molecular weight of 163.22 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diazenylmethyl)-N,N-dimethylaniline is sourced from PubChem (CID 57112857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).