C27H25N3O3S — CID 57113334
2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-(3,4-dimethylphenyl)-4-oxobut-2-enoic acid (PubChem CID 57113334) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-(3,4-dimethylphenyl)-4-oxobut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-(3,4-dimethylphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57113334 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-(3,4-dimethylphenyl)-4-oxobut-2-enoic acid |
| SMILES | Cc1ccc(C(=O)C(Cc2ccc(N(C)C)cc2)=C(C(=O)O)c2ccc3nsnc3c2)cc1C |
| InChI | InChI=1S/C27H25N3O3S/c1-16-5-8-20(13-17(16)2)26(31)22(14-18-6-10-21(11-7-18)30(3)4)25(27(32)33)19-9-12-23-24(15-19)29-34-28-23/h5-13,15H,14H2,1-4H3,(H,32,33) |
| InChIKey | NQYDOUXPVAMYHF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|