C14H17NO — CID 571134
1-(3,6-dihydro-2H-pyran-5-yl)-N-(1-phenylethyl)methanimine (PubChem CID 571134) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyran-5-yl)-N-(1-phenylethyl)methanimine.
| Compound Name | 1-(3,6-dihydro-2H-pyran-5-yl)-N-(1-phenylethyl)methanimine |
|---|---|
| PubChem CID | 571134 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyran-5-yl)-N-(1-phenylethyl)methanimine |
| SMILES | CC(/N=C/C1=CCCOC1)c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-12(14-7-3-2-4-8-14)15-10-13-6-5-9-16-11-13/h2-4,6-8,10,12H,5,9,11H2,1H3/b15-10+ |
| InChIKey | MOBDWZXYPARJHB-XNTDXEJSSA-N |
| XLogP | 3.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|